C14H16F3NO2 — CID 174645067
[2-[3-(trifluoromethyl)phenyl]piperidin-4-yl] acetate (PubChem CID 174645067) has the molecular formula C14H16F3NO2 and a molecular weight of 287.28 g/mol. Its IUPAC name is [2-[3-(trifluoromethyl)phenyl]piperidin-4-yl] acetate.
| Compound Name | [2-[3-(trifluoromethyl)phenyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 174645067 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [2-[3-(trifluoromethyl)phenyl]piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CCNC(c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H16F3NO2/c1-9(19)20-12-5-6-18-13(8-12)10-3-2-4-11(7-10)14(15,16)17/h2-4,7,12-13,18H,5-6,8H2,1H3 |
| InChIKey | FMTZNDPSSRUBRX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |