C15H17F4NO2 — CID 174645029
[2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl] acetate (PubChem CID 174645029) has the molecular formula C15H17F4NO2 and a molecular weight of 319.30 g/mol. Its IUPAC name is [2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl] acetate.
| Compound Name | [2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 174645029 |
| Molecular Formula | C15H17F4NO2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [2-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CCNC(Cc2ccc(C(F)(F)F)c(F)c2)C1 |
| InChI | InChI=1S/C15H17F4NO2/c1-9(21)22-12-4-5-20-11(8-12)6-10-2-3-13(14(16)7-10)15(17,18)19/h2-3,7,11-12,20H,4-6,8H2,1H3 |
| InChIKey | NAAAYKYSJYDWPV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |