C22H35NO2 — CID 174656857
[2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl] acetate (PubChem CID 174656857) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is [2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl] acetate.
| Compound Name | [2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl] acetate |
|---|---|
| PubChem CID | 174656857 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | [2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl] acetate |
| SMILES | CC(=O)OC1CCNC(Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C22H35NO2/c1-15(24)25-20-8-9-23-19(14-20)12-16-10-17(21(2,3)4)13-18(11-16)22(5,6)7/h10-11,13,19-20,23H,8-9,12,14H2,1-7H3 |
| InChIKey | GQKREUXYZOYHCL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |