C23H34N2O2 — CID 66732082
5-[(2S,4S)-2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 66732082) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 5-[(2S,4S)-2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2S,4S)-2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 66732082 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 5-[(2S,4S)-2-[(3,5-ditert-butylphenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | CC(C)(C)c1cc(C[C@@H]2C[C@@H](c3cc(=O)[nH]o3)CCN2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H34N2O2/c1-22(2,3)17-9-15(10-18(13-17)23(4,5)6)11-19-12-16(7-8-24-19)20-14-21(26)25-27-20/h9-10,13-14,16,19,24H,7-8,11-12H2,1-6H3,(H,25,26)/t16-,19+/m0/s1 |
| InChIKey | OUPSKNAUJWGGEE-QFBILLFUSA-N |
| XLogP | 4.64 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |