C15H18N2O2 — CID 87129192
5-[(2S,4R)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 87129192) has the molecular formula C15H18N2O2 and a molecular weight of 263.35 g/mol. Its IUPAC name is 5-[(2S,4R)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2S,4R)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 87129192 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 263.35 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 5-[(2S,4R)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | [2H]c1c([2H])c([2H])c(C[C@@H]2C[C@H](c3cc(=O)[nH]o3)CCN2)c([2H])c1[2H] |
| InChI | InChI=1S/C15H18N2O2/c18-15-10-14(19-17-15)12-6-7-16-13(9-12)8-11-4-2-1-3-5-11/h1-5,10,12-13,16H,6-9H2,(H,17,18)/t12-,13-/m1/s1/i1D,2D,3D,4D,5D |
| InChIKey | LNFPEBXLWIXQLF-CQPUGFLRSA-N |
| XLogP | 2.05 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |