C17H20N2O4 — CID 87477940
methyl (2R,4S)-4-(3-oxo-1,2-oxazol-5-yl)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidine-1-carboxylate (PubChem CID 87477940) has the molecular formula C17H20N2O4 and a molecular weight of 321.39 g/mol. Its IUPAC name is methyl (2R,4S)-4-(3-oxo-1,2-oxazol-5-yl)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidine-1-carboxylate.
| Compound Name | methyl (2R,4S)-4-(3-oxo-1,2-oxazol-5-yl)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87477940 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | methyl (2R,4S)-4-(3-oxo-1,2-oxazol-5-yl)-2-[(2,3,4,5,6-pentadeuteriophenyl)methyl]piperidine-1-carboxylate |
| SMILES | [2H]c1c([2H])c([2H])c(C[C@H]2C[C@@H](c3cc(=O)[nH]o3)CCN2C(=O)OC)c([2H])c1[2H] |
| InChI | InChI=1S/C17H20N2O4/c1-22-17(21)19-8-7-13(15-11-16(20)18-23-15)10-14(19)9-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3,(H,18,20)/t13-,14-/m0/s1/i2D,3D,4D,5D,6D |
| InChIKey | OPJBSXQRIJAYLF-UNLACKLKSA-N |
| XLogP | 2.53 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |