C16H15F3N2O4 — CID 66732486
4-(3-oxo-1,2-oxazol-5-yl)-2-[(3,4,5-trifluorophenyl)methyl]piperidine-1-carboxylic acid (PubChem CID 66732486) has the molecular formula C16H15F3N2O4 and a molecular weight of 356.30 g/mol. Its IUPAC name is 4-(3-oxo-1,2-oxazol-5-yl)-2-[(3,4,5-trifluorophenyl)methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-(3-oxo-1,2-oxazol-5-yl)-2-[(3,4,5-trifluorophenyl)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 66732486 |
| Molecular Formula | C16H15F3N2O4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 4-(3-oxo-1,2-oxazol-5-yl)-2-[(3,4,5-trifluorophenyl)methyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(c2cc(=O)[nH]o2)CC1Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C16H15F3N2O4/c17-11-4-8(5-12(18)15(11)19)3-10-6-9(1-2-21(10)16(23)24)13-7-14(22)20-25-13/h4-5,7,9-10H,1-3,6H2,(H,20,22)(H,23,24) |
| InChIKey | BZEROXZDCDXTFA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|