C17H20N2O4 — CID 66731658
methyl 2-benzyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate (PubChem CID 66731658) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is methyl 2-benzyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate.
| Compound Name | methyl 2-benzyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66731658 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | methyl 2-benzyl-4-(3-oxo-1,2-oxazol-5-yl)piperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(c2cc(=O)[nH]o2)CC1Cc1ccccc1 |
| InChI | InChI=1S/C17H20N2O4/c1-22-17(21)19-8-7-13(15-11-16(20)18-23-15)10-14(19)9-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3,(H,18,20) |
| InChIKey | OPJBSXQRIJAYLF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |