C15H24N2O3 — CID 66732687
5-[(2R,4S)-2-(cyclohexyloxymethyl)piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 66732687) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 5-[(2R,4S)-2-(cyclohexyloxymethyl)piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2R,4S)-2-(cyclohexyloxymethyl)piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 66732687 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 5-[(2R,4S)-2-(cyclohexyloxymethyl)piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc([C@H]2CCN[C@@H](COC3CCCCC3)C2)o[nH]1 |
| InChI | InChI=1S/C15H24N2O3/c18-15-9-14(20-17-15)11-6-7-16-12(8-11)10-19-13-4-2-1-3-5-13/h9,11-13,16H,1-8,10H2,(H,17,18)/t11-,12+/m0/s1 |
| InChIKey | NLVHSEHHKYHLSB-NWDGAFQWSA-N |
| XLogP | 2.15 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |