C16H26N2O4 — CID 174645063
acetic acid;5-[(2R,4S)-2-cyclohexylpiperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 174645063) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is acetic acid;5-[(2R,4S)-2-cyclohexylpiperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | acetic acid;5-[(2R,4S)-2-cyclohexylpiperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 174645063 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | acetic acid;5-[(2R,4S)-2-cyclohexylpiperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | CC(=O)O.O=c1cc([C@H]2CCN[C@@H](C3CCCCC3)C2)o[nH]1 |
| InChI | InChI=1S/C14H22N2O2.C2H4O2/c17-14-9-13(18-16-14)11-6-7-15-12(8-11)10-4-2-1-3-5-10;1-2(3)4/h9-12,15H,1-8H2,(H,16,17);1H3,(H,3,4)/t11-,12+;/m0./s1 |
| InChIKey | DEJZACQEPXDCCT-ZVWHLABXSA-N |
| XLogP | 2.47 |
| TPSA | 95.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |