C15H16F2N2O2 — CID 66732779
5-[(2R,4R)-2-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one (PubChem CID 66732779) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 5-[(2R,4R)-2-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one.
| Compound Name | 5-[(2R,4R)-2-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
|---|---|
| PubChem CID | 66732779 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 5-[(2R,4R)-2-[(3,5-difluorophenyl)methyl]piperidin-4-yl]-1,2-oxazol-3-one |
| SMILES | O=c1cc([C@@H]2CCN[C@@H](Cc3cc(F)cc(F)c3)C2)o[nH]1 |
| InChI | InChI=1S/C15H16F2N2O2/c16-11-3-9(4-12(17)7-11)5-13-6-10(1-2-18-13)14-8-15(20)19-21-14/h3-4,7-8,10,13,18H,1-2,5-6H2,(H,19,20)/t10-,13+/m1/s1 |
| InChIKey | IDXNHRVMJRCITA-MFKMUULPSA-N |
| XLogP | 2.32 |
| TPSA | 58.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |