C10H14N2OS — CID 114938311
2-(6-methoxy-3-pyridinyl)-5-methyl-1,3-thiazolidine (PubChem CID 114938311) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(6-methoxy-3-pyridinyl)-5-methyl-1,3-thiazolidine.
| Compound Name | 2-(6-methoxy-3-pyridinyl)-5-methyl-1,3-thiazolidine |
|---|---|
| PubChem CID | 114938311 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2-(6-methoxy-3-pyridinyl)-5-methyl-1,3-thiazolidine |
| SMILES | COc1ccc(C2NCC(C)S2)cn1 |
| InChI | InChI=1S/C10H14N2OS/c1-7-5-12-10(14-7)8-3-4-9(13-2)11-6-8/h3-4,6-7,10,12H,5H2,1-2H3 |
| InChIKey | APDKYMPZFZWGAA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |