C10H13BrNOS+ — CID 6940216
(2R)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium (PubChem CID 6940216) has the molecular formula C10H13BrNOS+ and a molecular weight of 275.19 g/mol. Its IUPAC name is (2R)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium.
| Compound Name | (2R)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium |
|---|---|
| PubChem CID | 6940216 |
| Molecular Formula | C10H13BrNOS+ |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (2R)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium |
| SMILES | COc1ccc([C@@H]2[NH2+]CCS2)cc1Br |
| InChI | InChI=1S/C10H12BrNOS/c1-13-9-3-2-7(6-8(9)11)10-12-4-5-14-10/h2-3,6,10,12H,4-5H2,1H3/p+1/t10-/m1/s1 |
| InChIKey | BMDCPEXAUFLROZ-SNVBAGLBSA-O |
| XLogP | 1.77 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |