C10H14NOS+ — CID 5043679
2-(2-methoxyphenyl)-1,3-thiazolidin-3-ium (PubChem CID 5043679) has the molecular formula C10H14NOS+ and a molecular weight of 196.30 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,3-thiazolidin-3-ium.
| Compound Name | 2-(2-methoxyphenyl)-1,3-thiazolidin-3-ium |
|---|---|
| PubChem CID | 5043679 |
| Molecular Formula | C10H14NOS+ |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,3-thiazolidin-3-ium |
| SMILES | COc1ccccc1C1[NH2+]CCS1 |
| InChI | InChI=1S/C10H13NOS/c1-12-9-5-3-2-4-8(9)10-11-6-7-13-10/h2-5,10-11H,6-7H2,1H3/p+1 |
| InChIKey | HJPJOKSJGDFDBQ-UHFFFAOYSA-O |
| XLogP | 1.00 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |