About (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium
(2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium (PubChem CID 6940215) has the molecular formula C10H13BrNOS+
and a molecular weight of 275.19 g/mol. Its IUPAC name is (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium.
Molecular Properties
| Compound Name | (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium |
| PubChem CID | 6940215 |
| Molecular Formula | C10H13BrNOS+ |
| Molecular Weight | 275.19 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium |
| SMILES | COc1ccc([C@H]2[NH2+]CCS2)cc1Br |
| InChI | InChI=1S/C10H12BrNOS/c1-13-9-3-2-7(6-8(9)11)10-12-4-5-14-10/h2-3,6,10,12H,4-5H2,1H3/p+1/t10-/m0/s1 |
| InChIKey | BMDCPEXAUFLROZ-JTQLQIEISA-O |
| XLogP | 1.77 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.19 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium?
The IUPAC name of (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium (CID 6940215) is (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium.
What is the SMILES notation for (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium?
The canonical SMILES for (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium is COc1ccc([C@H]2[NH2+]CCS2)cc1Br.
What is the InChIKey of (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium?
The InChIKey is BMDCPEXAUFLROZ-JTQLQIEISA-O. The full InChI is InChI=1S/C10H12BrNOS/c1-13-9-3-2-7(6-8(9)11)10-12-4-5-14-10/h2-3,6,10,12H,4-5H2,1H3/p+1/t10-/m0/s1.
What are the key properties of (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium?
(2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium has a molecular weight of 275.19 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(3-bromo-4-methoxyphenyl)-1,3-thiazolidin-3-ium is sourced from PubChem (CID 6940215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).