C11H16ClNO2S — CID 21241028
2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium chloride (PubChem CID 21241028) has the molecular formula C11H16ClNO2S and a molecular weight of 261.77 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium chloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium chloride |
|---|---|
| PubChem CID | 21241028 |
| Molecular Formula | C11H16ClNO2S |
| Molecular Weight | 261.77 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazolidin-3-ium chloride |
| SMILES | COc1ccc(C2[NH2+]CCS2)cc1OC.[Cl-] |
| InChI | InChI=1S/C11H15NO2S.ClH/c1-13-9-4-3-8(7-10(9)14-2)11-12-5-6-15-11;/h3-4,7,11-12H,5-6H2,1-2H3;1H |
| InChIKey | HXCXKUFOOOCBTP-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.77 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |