C10H12N2O — CID 3031281
5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazole (PubChem CID 3031281) has the molecular formula C10H12N2O and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazole.
| Compound Name | 5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazole |
|---|---|
| PubChem CID | 3031281 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 5-(2-methoxyphenyl)-4,5-dihydro-1H-pyrazole |
| SMILES | COc1ccccc1C1CC=NN1 |
| InChI | InChI=1S/C10H12N2O/c1-13-10-5-3-2-4-8(10)9-6-7-11-12-9/h2-5,7,9,12H,6H2,1H3 |
| InChIKey | WMELTQWIPRJNNI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |