C10H13NO3S — CID 105484645
2-(1,1-dioxo-1,4-thiazinan-3-yl)phenol (PubChem CID 105484645) has the molecular formula C10H13NO3S and a molecular weight of 227.28 g/mol. Its IUPAC name is 2-(1,1-dioxo-1,4-thiazinan-3-yl)phenol.
| Compound Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)phenol |
|---|---|
| PubChem CID | 105484645 |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.06 |
| IUPAC Name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)phenol |
| SMILES | O=S1(=O)CCNC(c2ccccc2O)C1 |
| InChI | InChI=1S/C10H13NO3S/c12-10-4-2-1-3-8(10)9-7-15(13,14)6-5-11-9/h1-4,9,11-12H,5-7H2 |
| InChIKey | LFAOGMQSIIEGMR-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|