C11H12O5S — CID 84805326
4-(2-hydroxyphenyl)-1,1-dioxothiolane-3-carboxylic acid (PubChem CID 84805326) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-1,1-dioxothiolane-3-carboxylic acid.
| Compound Name | 4-(2-hydroxyphenyl)-1,1-dioxothiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 84805326 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | 4-(2-hydroxyphenyl)-1,1-dioxothiolane-3-carboxylic acid |
| SMILES | O=C(O)C1CS(=O)(=O)CC1c1ccccc1O |
| InChI | InChI=1S/C11H12O5S/c12-10-4-2-1-3-7(10)8-5-17(15,16)6-9(8)11(13)14/h1-4,8-9,12H,5-6H2,(H,13,14) |
| InChIKey | ZYTIPNKALOZWFS-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |