C11H11NO4 — CID 96607570
(2S,3S)-2-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 96607570) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is (2S,3S)-2-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | (2S,3S)-2-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 96607570 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (2S,3S)-2-(2-hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C1C[C@H](C(=O)O)[C@@H](c2ccccc2O)N1 |
| InChI | InChI=1S/C11H11NO4/c13-8-4-2-1-3-6(8)10-7(11(15)16)5-9(14)12-10/h1-4,7,10,13H,5H2,(H,12,14)(H,15,16)/t7-,10+/m0/s1 |
| InChIKey | OCJNZQVZIONRBG-OIBJUYFYSA-N |
| XLogP | 0.65 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|