C12H17NO4S2 — CID 66217064
3-(4-methylsulfonylphenyl)-1,4-thiazepane 1,1-dioxide (PubChem CID 66217064) has the molecular formula C12H17NO4S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-1,4-thiazepane 1,1-dioxide.
| Compound Name | 3-(4-methylsulfonylphenyl)-1,4-thiazepane 1,1-dioxide |
|---|---|
| PubChem CID | 66217064 |
| Molecular Formula | C12H17NO4S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.06 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-1,4-thiazepane 1,1-dioxide |
| SMILES | CS(=O)(=O)c1ccc(C2CS(=O)(=O)CCCN2)cc1 |
| InChI | InChI=1S/C12H17NO4S2/c1-18(14,15)11-5-3-10(4-6-11)12-9-19(16,17)8-2-7-13-12/h3-6,12-13H,2,7-9H2,1H3 |
| InChIKey | DQMQKLANMSGMQM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |