C10H9NO4S — CID 142711103
(4S)-4-(1-benzofuran-2-yl)oxathiazolidine 2,2-dioxide (PubChem CID 142711103) has the molecular formula C10H9NO4S and a molecular weight of 239.25 g/mol. Its IUPAC name is (4S)-4-(1-benzofuran-2-yl)oxathiazolidine 2,2-dioxide.
| Compound Name | (4S)-4-(1-benzofuran-2-yl)oxathiazolidine 2,2-dioxide |
|---|---|
| PubChem CID | 142711103 |
| Molecular Formula | C10H9NO4S |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | (4S)-4-(1-benzofuran-2-yl)oxathiazolidine 2,2-dioxide |
| SMILES | O=S1(=O)N[C@H](c2cc3ccccc3o2)CO1 |
| InChI | InChI=1S/C10H9NO4S/c12-16(13)11-8(6-14-16)10-5-7-3-1-2-4-9(7)15-10/h1-5,8,11H,6H2/t8-/m0/s1 |
| InChIKey | QEXGOBWYTQEYPM-QMMMGPOBSA-N |
| XLogP | 1.34 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |