C15H21NO4S — CID 3817985
2-(3,4-dimethoxyphenyl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one (PubChem CID 3817985) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3817985 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one |
| SMILES | CCOCCN1C(=O)CSC1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H21NO4S/c1-4-20-8-7-16-14(17)10-21-15(16)11-5-6-12(18-2)13(9-11)19-3/h5-6,9,15H,4,7-8,10H2,1-3H3 |
| InChIKey | AZYFKBGDLNQACC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|