C12H16N2O2S — CID 3670137
3-(3-methoxypropyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one (PubChem CID 3670137) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-methoxypropyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3670137 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 3-(3-methoxypropyl)-2-pyridin-4-yl-1,3-thiazolidin-4-one |
| SMILES | COCCCN1C(=O)CSC1c1ccncc1 |
| InChI | InChI=1S/C12H16N2O2S/c1-16-8-2-7-14-11(15)9-17-12(14)10-3-5-13-6-4-10/h3-6,12H,2,7-9H2,1H3 |
| InChIKey | LPYXKFCHEJYAID-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|