C11H14BrNO2S2 — CID 3773919
2-(5-bromothiophen-2-yl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one (PubChem CID 3773919) has the molecular formula C11H14BrNO2S2 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(5-bromothiophen-2-yl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3773919 |
| Molecular Formula | C11H14BrNO2S2 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-3-(2-ethoxyethyl)-1,3-thiazolidin-4-one |
| SMILES | CCOCCN1C(=O)CSC1c1ccc(Br)s1 |
| InChI | InChI=1S/C11H14BrNO2S2/c1-2-15-6-5-13-10(14)7-16-11(13)8-3-4-9(12)17-8/h3-4,11H,2,5-7H2,1H3 |
| InChIKey | XSAOVDGNKULBQD-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|