C19H20N2O3S — CID 10360916
2-(3-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-1,3-thiazolidin-4-one (PubChem CID 10360916) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 10360916 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(3-hydroxyphenyl)-3-(4-morpholin-4-ylphenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccc(O)c2)N1c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c22-17-3-1-2-14(12-17)19-21(18(23)13-25-19)16-6-4-15(5-7-16)20-8-10-24-11-9-20/h1-7,12,19,22H,8-11,13H2 |
| InChIKey | OYJKNRAICUXKKK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|