C21H19ClN2O2 — CID 2325107
(4Z)-2-(2-chlorophenyl)-4-(piperidin-1-ylmethylidene)isoquinoline-1,3-dione (PubChem CID 2325107) has the molecular formula C21H19ClN2O2 and a molecular weight of 366.85 g/mol. Its IUPAC name is (4Z)-2-(2-chlorophenyl)-4-(piperidin-1-ylmethylidene)isoquinoline-1,3-dione.
| Compound Name | (4Z)-2-(2-chlorophenyl)-4-(piperidin-1-ylmethylidene)isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 2325107 |
| Molecular Formula | C21H19ClN2O2 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (4Z)-2-(2-chlorophenyl)-4-(piperidin-1-ylmethylidene)isoquinoline-1,3-dione |
| SMILES | O=C1/C(=C\N2CCCCC2)c2ccccc2C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C21H19ClN2O2/c22-18-10-4-5-11-19(18)24-20(25)16-9-3-2-8-15(16)17(21(24)26)14-23-12-6-1-7-13-23/h2-5,8-11,14H,1,6-7,12-13H2/b17-14- |
| InChIKey | VGWMXSQVYSDIJO-VKAVYKQESA-N |
| XLogP | 4.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|