C21H18N2O2S — CID 142664701
4-(3-methoxy-4-phenylmethoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole (PubChem CID 142664701) has the molecular formula C21H18N2O2S and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-(3-methoxy-4-phenylmethoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole.
| Compound Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole |
|---|---|
| PubChem CID | 142664701 |
| Molecular Formula | C21H18N2O2S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 4-(3-methoxy-4-phenylmethoxyphenyl)-2-pyrrol-1-yl-1,3-thiazole |
| SMILES | COc1cc(-c2csc(-n3cccc3)n2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C21H18N2O2S/c1-24-20-13-17(18-15-26-21(22-18)23-11-5-6-12-23)9-10-19(20)25-14-16-7-3-2-4-8-16/h2-13,15H,14H2,1H3 |
| InChIKey | SSLNFZQNKKMTTL-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |