C24H20FN3O2S — CID 3425787
4-(4-fluorophenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine (PubChem CID 3425787) has the molecular formula C24H20FN3O2S and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(4-fluorophenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 3425787 |
| Molecular Formula | C24H20FN3O2S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]-1,3-thiazol-2-amine |
| SMILES | COc1cc(C=NNc2nc(-c3ccc(F)cc3)cs2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C24H20FN3O2S/c1-29-23-13-18(7-12-22(23)30-15-17-5-3-2-4-6-17)14-26-28-24-27-21(16-31-24)19-8-10-20(25)11-9-19/h2-14,16H,15H2,1H3,(H,27,28) |
| InChIKey | VDJBKAVGXYKTKC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|