C24H18Cl2FN3O2S — CID 4140219
4-(2,4-dichlorophenyl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 4140219) has the molecular formula C24H18Cl2FN3O2S and a molecular weight of 502.40 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 4140219 |
| Molecular Formula | C24H18Cl2FN3O2S |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 501.05 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | COc1cc(C=NNc2nc(-c3ccc(Cl)cc3Cl)cs2)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C24H18Cl2FN3O2S/c1-31-23-10-16(4-9-22(23)32-13-15-2-6-18(27)7-3-15)12-28-30-24-29-21(14-33-24)19-8-5-17(25)11-20(19)26/h2-12,14H,13H2,1H3,(H,29,30) |
| InChIKey | ZNMMBFDARDTULI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|