C25H19Cl4N3O2S — CID 6238710
4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1,3-thiazol-2-amine (PubChem CID 6238710) has the molecular formula C25H19Cl4N3O2S and a molecular weight of 567.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 6238710 |
| Molecular Formula | C25H19Cl4N3O2S |
| Molecular Weight | 567.33 g/mol |
| Exact Mass | 565.00 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[(Z)-[4-[(3,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]methylideneamino]-1,3-thiazol-2-amine |
| SMILES | CCOc1cc(/C=N\Nc2nc(-c3ccc(Cl)cc3Cl)cs2)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl4N3O2S/c1-2-33-24-10-15(4-8-23(24)34-13-16-3-7-19(27)21(29)9-16)12-30-32-25-31-22(14-35-25)18-6-5-17(26)11-20(18)28/h3-12,14H,2,13H2,1H3,(H,31,32)/b30-12- |
| InChIKey | OXGFGOMICABOAL-FTCYSYDXSA-N |
| XLogP | 8.85 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.33 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|