C24H23ClFNO5S — CID 69234078
methyl 5-[[4-(3-chloro-4-fluorophenoxy)phenyl]-ethylsulfamoyl]-2-ethylbenzoate (PubChem CID 69234078) has the molecular formula C24H23ClFNO5S and a molecular weight of 491.97 g/mol. Its IUPAC name is methyl 5-[[4-(3-chloro-4-fluorophenoxy)phenyl]-ethylsulfamoyl]-2-ethylbenzoate.
| Compound Name | methyl 5-[[4-(3-chloro-4-fluorophenoxy)phenyl]-ethylsulfamoyl]-2-ethylbenzoate |
|---|---|
| PubChem CID | 69234078 |
| Molecular Formula | C24H23ClFNO5S |
| Molecular Weight | 491.97 g/mol |
| Exact Mass | 491.10 |
| IUPAC Name | methyl 5-[[4-(3-chloro-4-fluorophenoxy)phenyl]-ethylsulfamoyl]-2-ethylbenzoate |
| SMILES | CCc1ccc(S(=O)(=O)N(CC)c2ccc(Oc3ccc(F)c(Cl)c3)cc2)cc1C(=O)OC |
| InChI | InChI=1S/C24H23ClFNO5S/c1-4-16-6-12-20(15-21(16)24(28)31-3)33(29,30)27(5-2)17-7-9-18(10-8-17)32-19-11-13-23(26)22(25)14-19/h6-15H,4-5H2,1-3H3 |
| InChIKey | CULKZXWVDNXETN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.97 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |