C18H20ClNO5S — CID 100557630
methyl 2-chloro-5-[2-(4-ethylphenoxy)ethylsulfamoyl]benzoate (PubChem CID 100557630) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is methyl 2-chloro-5-[2-(4-ethylphenoxy)ethylsulfamoyl]benzoate.
| Compound Name | methyl 2-chloro-5-[2-(4-ethylphenoxy)ethylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 100557630 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl 2-chloro-5-[2-(4-ethylphenoxy)ethylsulfamoyl]benzoate |
| SMILES | CCc1ccc(OCCNS(=O)(=O)c2ccc(Cl)c(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C18H20ClNO5S/c1-3-13-4-6-14(7-5-13)25-11-10-20-26(22,23)15-8-9-17(19)16(12-15)18(21)24-2/h4-9,12,20H,3,10-11H2,1-2H3 |
| InChIKey | UDYKZLVZOYWJLK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|