C19H22ClN3O5S — CID 24625182
2-chloro-N-[2-(dimethylamino)-2-oxoethyl]-5-(2-phenoxyethylsulfamoyl)benzamide (PubChem CID 24625182) has the molecular formula C19H22ClN3O5S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-chloro-N-[2-(dimethylamino)-2-oxoethyl]-5-(2-phenoxyethylsulfamoyl)benzamide.
| Compound Name | 2-chloro-N-[2-(dimethylamino)-2-oxoethyl]-5-(2-phenoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24625182 |
| Molecular Formula | C19H22ClN3O5S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-chloro-N-[2-(dimethylamino)-2-oxoethyl]-5-(2-phenoxyethylsulfamoyl)benzamide |
| SMILES | CN(C)C(=O)CNC(=O)c1cc(S(=O)(=O)NCCOc2ccccc2)ccc1Cl |
| InChI | InChI=1S/C19H22ClN3O5S/c1-23(2)18(24)13-21-19(25)16-12-15(8-9-17(16)20)29(26,27)22-10-11-28-14-6-4-3-5-7-14/h3-9,12,22H,10-11,13H2,1-2H3,(H,21,25) |
| InChIKey | RRNBPTQGRBPNDD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|