C17H21NO4S3 — CID 55904601
4-ethylsulfonyl-N-[2-(4-methylphenyl)sulfanylethyl]benzenesulfonamide (PubChem CID 55904601) has the molecular formula C17H21NO4S3 and a molecular weight of 399.56 g/mol. Its IUPAC name is 4-ethylsulfonyl-N-[2-(4-methylphenyl)sulfanylethyl]benzenesulfonamide.
| Compound Name | 4-ethylsulfonyl-N-[2-(4-methylphenyl)sulfanylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55904601 |
| Molecular Formula | C17H21NO4S3 |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-ethylsulfonyl-N-[2-(4-methylphenyl)sulfanylethyl]benzenesulfonamide |
| SMILES | CCS(=O)(=O)c1ccc(S(=O)(=O)NCCSc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H21NO4S3/c1-3-24(19,20)16-8-10-17(11-9-16)25(21,22)18-12-13-23-15-6-4-14(2)5-7-15/h4-11,18H,3,12-13H2,1-2H3 |
| InChIKey | NYSJWUOLFVXBID-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|