C18H24N2O4S3 — CID 67599725
N-[4-[4-(methanesulfonamido)phenyl]sulfanylbutyl]-4-methylbenzenesulfonamide (PubChem CID 67599725) has the molecular formula C18H24N2O4S3 and a molecular weight of 428.60 g/mol. Its IUPAC name is N-[4-[4-(methanesulfonamido)phenyl]sulfanylbutyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[4-(methanesulfonamido)phenyl]sulfanylbutyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 67599725 |
| Molecular Formula | C18H24N2O4S3 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[4-[4-(methanesulfonamido)phenyl]sulfanylbutyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCSc2ccc(NS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C18H24N2O4S3/c1-15-5-11-18(12-6-15)27(23,24)19-13-3-4-14-25-17-9-7-16(8-10-17)20-26(2,21)22/h5-12,19-20H,3-4,13-14H2,1-2H3 |
| InChIKey | KTDFNBDZADLIGL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|