C15H27N3O4S2 — CID 15599388
N-[2-[di(propan-2-yl)amino]ethyl]-4-(methanesulfonamido)benzenesulfonamide (PubChem CID 15599388) has the molecular formula C15H27N3O4S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[2-[di(propan-2-yl)amino]ethyl]-4-(methanesulfonamido)benzenesulfonamide.
| Compound Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-(methanesulfonamido)benzenesulfonamide |
|---|---|
| PubChem CID | 15599388 |
| Molecular Formula | C15H27N3O4S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[2-[di(propan-2-yl)amino]ethyl]-4-(methanesulfonamido)benzenesulfonamide |
| SMILES | CC(C)N(CCNS(=O)(=O)c1ccc(NS(C)(=O)=O)cc1)C(C)C |
| InChI | InChI=1S/C15H27N3O4S2/c1-12(2)18(13(3)4)11-10-16-24(21,22)15-8-6-14(7-9-15)17-23(5,19)20/h6-9,12-13,16-17H,10-11H2,1-5H3 |
| InChIKey | HWFCXIHJRGCALX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |