C16H17F2NO2S2 — CID 39632696
3-fluoro-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methylbenzenesulfonamide (PubChem CID 39632696) has the molecular formula C16H17F2NO2S2 and a molecular weight of 357.45 g/mol. Its IUPAC name is 3-fluoro-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methylbenzenesulfonamide.
| Compound Name | 3-fluoro-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 39632696 |
| Molecular Formula | C16H17F2NO2S2 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-fluoro-N-[3-(4-fluorophenyl)sulfanylpropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCSc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C16H17F2NO2S2/c1-12-3-8-15(11-16(12)18)23(20,21)19-9-2-10-22-14-6-4-13(17)5-7-14/h3-8,11,19H,2,9-10H2,1H3 |
| InChIKey | XVZWHMHQOXCNED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|