C13H19FN2O2S — CID 43598658
N-[3-(cyclopropylamino)propyl]-3-fluoro-4-methylbenzenesulfonamide (PubChem CID 43598658) has the molecular formula C13H19FN2O2S and a molecular weight of 286.37 g/mol. Its IUPAC name is N-[3-(cyclopropylamino)propyl]-3-fluoro-4-methylbenzenesulfonamide.
| Compound Name | N-[3-(cyclopropylamino)propyl]-3-fluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 43598658 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | N-[3-(cyclopropylamino)propyl]-3-fluoro-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNC2CC2)cc1F |
| InChI | InChI=1S/C13H19FN2O2S/c1-10-3-6-12(9-13(10)14)19(17,18)16-8-2-7-15-11-4-5-11/h3,6,9,11,15-16H,2,4-5,7-8H2,1H3 |
| InChIKey | SJMVONWOSCRODS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|