C15H16FNO5S2 — CID 54774411
4-fluoro-N-[2-(4-methoxyphenyl)sulfonylethyl]benzenesulfonamide (PubChem CID 54774411) has the molecular formula C15H16FNO5S2 and a molecular weight of 373.43 g/mol. Its IUPAC name is 4-fluoro-N-[2-(4-methoxyphenyl)sulfonylethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-(4-methoxyphenyl)sulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54774411 |
| Molecular Formula | C15H16FNO5S2 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 4-fluoro-N-[2-(4-methoxyphenyl)sulfonylethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)CCNS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C15H16FNO5S2/c1-22-13-4-8-14(9-5-13)23(18,19)11-10-17-24(20,21)15-6-2-12(16)3-7-15/h2-9,17H,10-11H2,1H3 |
| InChIKey | TWKGLKCCEIZFRY-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |