C16H18FNO5S2 — CID 54774369
4-ethoxy-N-[2-(4-fluorophenyl)sulfonylethyl]benzenesulfonamide (PubChem CID 54774369) has the molecular formula C16H18FNO5S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 4-ethoxy-N-[2-(4-fluorophenyl)sulfonylethyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-N-[2-(4-fluorophenyl)sulfonylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 54774369 |
| Molecular Formula | C16H18FNO5S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-ethoxy-N-[2-(4-fluorophenyl)sulfonylethyl]benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H18FNO5S2/c1-2-23-14-5-9-16(10-6-14)25(21,22)18-11-12-24(19,20)15-7-3-13(17)4-8-15/h3-10,18H,2,11-12H2,1H3 |
| InChIKey | ZGAJQPCNJFKNPR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |