About N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide
N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 113082410) has the molecular formula C14H11FN2O4S2
and a molecular weight of 354.38 g/mol. Its IUPAC name is N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide |
| PubChem CID | 113082410 |
| Molecular Formula | C14H11FN2O4S2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=C1c2cccc(F)c2C(=O)N1CCNS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C14H11FN2O4S2/c15-10-4-1-3-9-12(10)14(19)17(13(9)18)7-6-16-23(20,21)11-5-2-8-22-11/h1-5,8,16H,6-7H2 |
| InChIKey | PSSSACABZXZYKI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide?
The IUPAC name of N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide (CID 113082410) is N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide.
What is the SMILES notation for N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide?
The canonical SMILES for N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide is O=C1c2cccc(F)c2C(=O)N1CCNS(=O)(=O)c1cccs1.
What is the InChIKey of N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide?
The InChIKey is PSSSACABZXZYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2O4S2/c15-10-4-1-3-9-12(10)14(19)17(13(9)18)7-6-16-23(20,21)11-5-2-8-22-11/h1-5,8,16H,6-7H2.
What are the key properties of N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide?
N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide has a molecular weight of 354.38 g/mol, XLogP of 1.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]thiophene-2-sulfonamide is sourced from PubChem (CID 113082410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).