About 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide
2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide (PubChem CID 113082330) has the molecular formula C16H19FN2O3
and a molecular weight of 306.34 g/mol. Its IUPAC name is 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide |
| PubChem CID | 113082330 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide |
| SMILES | CCC(CC)C(=O)NCCN1C(=O)c2cccc(F)c2C1=O |
| InChI | InChI=1S/C16H19FN2O3/c1-3-10(4-2)14(20)18-8-9-19-15(21)11-6-5-7-12(17)13(11)16(19)22/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,20) |
| InChIKey | DSSSEGCFEFNERH-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide?
The IUPAC name of 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide (CID 113082330) is 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide.
What is the SMILES notation for 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide?
The canonical SMILES for 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide is CCC(CC)C(=O)NCCN1C(=O)c2cccc(F)c2C1=O.
What is the InChIKey of 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide?
The InChIKey is DSSSEGCFEFNERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN2O3/c1-3-10(4-2)14(20)18-8-9-19-15(21)11-6-5-7-12(17)13(11)16(19)22/h5-7,10H,3-4,8-9H2,1-2H3,(H,18,20).
What are the key properties of 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide?
2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide has a molecular weight of 306.34 g/mol, XLogP of 1.97, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-[2-(4-fluoro-1,3-dioxoisoindol-2-yl)ethyl]butanamide is sourced from PubChem (CID 113082330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).