C14H14FNO5 — CID 10040144
methyl (2R,3R)-2-[(4-fluoro-1,3-dioxoisoindol-2-yl)methyl]-3-hydroxybutanoate (PubChem CID 10040144) has the molecular formula C14H14FNO5 and a molecular weight of 295.27 g/mol. Its IUPAC name is methyl (2R,3R)-2-[(4-fluoro-1,3-dioxoisoindol-2-yl)methyl]-3-hydroxybutanoate.
| Compound Name | methyl (2R,3R)-2-[(4-fluoro-1,3-dioxoisoindol-2-yl)methyl]-3-hydroxybutanoate |
|---|---|
| PubChem CID | 10040144 |
| Molecular Formula | C14H14FNO5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl (2R,3R)-2-[(4-fluoro-1,3-dioxoisoindol-2-yl)methyl]-3-hydroxybutanoate |
| SMILES | COC(=O)[C@H](CN1C(=O)c2cccc(F)c2C1=O)[C@@H](C)O |
| InChI | InChI=1S/C14H14FNO5/c1-7(17)9(14(20)21-2)6-16-12(18)8-4-3-5-10(15)11(8)13(16)19/h3-5,7,9,17H,6H2,1-2H3/t7-,9-/m1/s1 |
| InChIKey | LTGZVWQGWXPXHC-VXNVDRBHSA-N |
| XLogP | 0.59 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|