C15H17NO6 — CID 10425311
methyl (2S,3R)-3-hydroxy-2-[(4-methoxy-1,3-dioxoisoindol-2-yl)methyl]butanoate (PubChem CID 10425311) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[(4-methoxy-1,3-dioxoisoindol-2-yl)methyl]butanoate.
| Compound Name | methyl (2S,3R)-3-hydroxy-2-[(4-methoxy-1,3-dioxoisoindol-2-yl)methyl]butanoate |
|---|---|
| PubChem CID | 10425311 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | methyl (2S,3R)-3-hydroxy-2-[(4-methoxy-1,3-dioxoisoindol-2-yl)methyl]butanoate |
| SMILES | COC(=O)[C@@H](CN1C(=O)c2cccc(OC)c2C1=O)[C@@H](C)O |
| InChI | InChI=1S/C15H17NO6/c1-8(17)10(15(20)22-3)7-16-13(18)9-5-4-6-11(21-2)12(9)14(16)19/h4-6,8,10,17H,7H2,1-3H3/t8-,10+/m1/s1 |
| InChIKey | VFIUUWNZYUXOBU-SCZZXKLOSA-N |
| XLogP | 0.46 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|