C17H20N2O7 — CID 42638687
dimethyl (2S)-2-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]butanedioate (PubChem CID 42638687) has the molecular formula C17H20N2O7 and a molecular weight of 364.35 g/mol. Its IUPAC name is dimethyl (2S)-2-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]butanedioate |
|---|---|
| PubChem CID | 42638687 |
| Molecular Formula | C17H20N2O7 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | dimethyl (2S)-2-[[3-(1,3-dioxoisoindol-2-yl)-2-hydroxypropyl]amino]butanedioate |
| SMILES | COC(=O)C[C@H](NCC(O)CN1C(=O)c2ccccc2C1=O)C(=O)OC |
| InChI | InChI=1S/C17H20N2O7/c1-25-14(21)7-13(17(24)26-2)18-8-10(20)9-19-15(22)11-5-3-4-6-12(11)16(19)23/h3-6,10,13,18,20H,7-9H2,1-2H3/t10?,13-/m0/s1 |
| InChIKey | HVLHDUCKAWSMCV-HQVZTVAUSA-N |
| XLogP | -0.66 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|