C20H21N3O3 — CID 29130862
N-[2-[(4-methoxybenzoyl)amino]ethyl]-1-methylindole-2-carboxamide (PubChem CID 29130862) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-[(4-methoxybenzoyl)amino]ethyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[2-[(4-methoxybenzoyl)amino]ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 29130862 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | N-[2-[(4-methoxybenzoyl)amino]ethyl]-1-methylindole-2-carboxamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)c2cc3ccccc3n2C)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-23-17-6-4-3-5-15(17)13-18(23)20(25)22-12-11-21-19(24)14-7-9-16(26-2)10-8-14/h3-10,13H,11-12H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | VYGCKNFLBGPKFB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|