C24H26N4O4 — CID 42653320
N-[2-[[1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]-1-methylindole-2-carboxamide (PubChem CID 42653320) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[2-[[1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[2-[[1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 42653320 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[2-[[1-(3-methoxyphenyl)-5-oxopyrrolidine-3-carbonyl]amino]ethyl]-1-methylindole-2-carboxamide |
| SMILES | COc1cccc(N2CC(C(=O)NCCNC(=O)c3cc4ccccc4n3C)CC2=O)c1 |
| InChI | InChI=1S/C24H26N4O4/c1-27-20-9-4-3-6-16(20)12-21(27)24(31)26-11-10-25-23(30)17-13-22(29)28(15-17)18-7-5-8-19(14-18)32-2/h3-9,12,14,17H,10-11,13,15H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | OUZMIMXZGCZLIA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|