C17H22N2O3 — CID 167310044
3-[(1-methylindole-2-carbonyl)amino]propyl butanoate (PubChem CID 167310044) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 3-[(1-methylindole-2-carbonyl)amino]propyl butanoate.
| Compound Name | 3-[(1-methylindole-2-carbonyl)amino]propyl butanoate |
|---|---|
| PubChem CID | 167310044 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-[(1-methylindole-2-carbonyl)amino]propyl butanoate |
| SMILES | CCCC(=O)OCCCNC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C17H22N2O3/c1-3-7-16(20)22-11-6-10-18-17(21)15-12-13-8-4-5-9-14(13)19(15)2/h4-5,8-9,12H,3,6-7,10-11H2,1-2H3,(H,18,21) |
| InChIKey | LXPQDROKHXBUOD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|