C18H17FN2O3S — CID 71708611
N-[2-(4-fluorophenyl)sulfonylethyl]-1-methylindole-2-carboxamide (PubChem CID 71708611) has the molecular formula C18H17FN2O3S and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)sulfonylethyl]-1-methylindole-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)sulfonylethyl]-1-methylindole-2-carboxamide |
|---|---|
| PubChem CID | 71708611 |
| Molecular Formula | C18H17FN2O3S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[2-(4-fluorophenyl)sulfonylethyl]-1-methylindole-2-carboxamide |
| SMILES | Cn1c(C(=O)NCCS(=O)(=O)c2ccc(F)cc2)cc2ccccc21 |
| InChI | InChI=1S/C18H17FN2O3S/c1-21-16-5-3-2-4-13(16)12-17(21)18(22)20-10-11-25(23,24)15-8-6-14(19)7-9-15/h2-9,12H,10-11H2,1H3,(H,20,22) |
| InChIKey | HQYLHASJUXGIFT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |